About cyclopropyl 2,2,2-trifluoroacetate;1,2-oxazole-3-carboxylic acid
cyclopropyl 2,2,2-trifluoroacetate;1,2-oxazole-3-carboxylic acid (PubChem CID 174573657) has the molecular formula C9H8F3NO5
and a molecular weight of 267.16 g/mol. Its IUPAC name is cyclopropyl 2,2,2-trifluoroacetate;1,2-oxazole-3-carboxylic acid.
Analyze cyclopropyl 2,2,2-trifluoroacetate;1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl 2,2,2-trifluoroacetate;1,2-oxazole-3-carboxylic acid?
The IUPAC name of cyclopropyl 2,2,2-trifluoroacetate;1,2-oxazole-3-carboxylic acid (CID 174573657) is cyclopropyl 2,2,2-trifluoroacetate;1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for cyclopropyl 2,2,2-trifluoroacetate;1,2-oxazole-3-carboxylic acid?
The canonical SMILES for cyclopropyl 2,2,2-trifluoroacetate;1,2-oxazole-3-carboxylic acid is O=C(O)c1ccon1.O=C(OC1CC1)C(F)(F)F.
What is the InChIKey of cyclopropyl 2,2,2-trifluoroacetate;1,2-oxazole-3-carboxylic acid?
The InChIKey is KTZPTRPLKPIJFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F3O2.C4H3NO3/c6-5(7,8)4(9)10-3-1-2-3;6-4(7)3-1-2-8-5-3/h3H,1-2H2;1-2H,(H,6,7).
What are the key properties of cyclopropyl 2,2,2-trifluoroacetate;1,2-oxazole-3-carboxylic acid?
cyclopropyl 2,2,2-trifluoroacetate;1,2-oxazole-3-carboxylic acid has a molecular weight of 267.16 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl 2,2,2-trifluoroacetate;1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 174573657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).