C21H22F3N3O5S — CID 174575923
2-[2-hydroxy-5-[1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]prop-2-enylsulfonyl]phenyl]acetic acid (PubChem CID 174575923) has the molecular formula C21H22F3N3O5S and a molecular weight of 485.48 g/mol. Its IUPAC name is 2-[2-hydroxy-5-[1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]prop-2-enylsulfonyl]phenyl]acetic acid.
| Compound Name | 2-[2-hydroxy-5-[1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]prop-2-enylsulfonyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 174575923 |
| Molecular Formula | C21H22F3N3O5S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 2-[2-hydroxy-5-[1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]prop-2-enylsulfonyl]phenyl]acetic acid |
| SMILES | C=CC(N1CCN(c2ccc(C(F)(F)F)cn2)CC1)S(=O)(=O)c1ccc(O)c(CC(=O)O)c1 |
| InChI | InChI=1S/C21H22F3N3O5S/c1-2-19(33(31,32)16-4-5-17(28)14(11-16)12-20(29)30)27-9-7-26(8-10-27)18-6-3-15(13-25-18)21(22,23)24/h2-6,11,13,19,28H,1,7-10,12H2,(H,29,30) |
| InChIKey | YSGYNACCGCSVTI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|