C25H31ClN2O5 — CID 174576833
tert-butyl 2-(6-chloro-2-oxo-3H-benzimidazol-1-yl)-3-phenylpropanoate;tert-butyl formate (PubChem CID 174576833) has the molecular formula C25H31ClN2O5 and a molecular weight of 474.99 g/mol. Its IUPAC name is tert-butyl 2-(6-chloro-2-oxo-3H-benzimidazol-1-yl)-3-phenylpropanoate;tert-butyl formate.
| Compound Name | tert-butyl 2-(6-chloro-2-oxo-3H-benzimidazol-1-yl)-3-phenylpropanoate;tert-butyl formate |
|---|---|
| PubChem CID | 174576833 |
| Molecular Formula | C25H31ClN2O5 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | tert-butyl 2-(6-chloro-2-oxo-3H-benzimidazol-1-yl)-3-phenylpropanoate;tert-butyl formate |
| SMILES | CC(C)(C)OC(=O)C(Cc1ccccc1)n1c(=O)[nH]c2ccc(Cl)cc21.CC(C)(C)OC=O |
| InChI | InChI=1S/C20H21ClN2O3.C5H10O2/c1-20(2,3)26-18(24)17(11-13-7-5-4-6-8-13)23-16-12-14(21)9-10-15(16)22-19(23)25;1-5(2,3)7-4-6/h4-10,12,17H,11H2,1-3H3,(H,22,25);4H,1-3H3 |
| InChIKey | SUVSYJREOMTCQL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|