About oxovanadium;propanoic acid
oxovanadium;propanoic acid (PubChem CID 174579609) has the molecular formula C3H6O3V
and a molecular weight of 141.02 g/mol. Its IUPAC name is oxovanadium;propanoic acid.
Molecular Properties
| Compound Name | oxovanadium;propanoic acid |
| PubChem CID | 174579609 |
| Molecular Formula | C3H6O3V |
| Molecular Weight | 141.02 g/mol |
| Exact Mass | 140.98 |
| IUPAC Name | oxovanadium;propanoic acid |
| SMILES | CCC(=O)O.O=[V] |
| InChI | InChI=1S/C3H6O2.O.V/c1-2-3(4)5;;/h2H2,1H3,(H,4,5);; |
| InChIKey | WILNATAGHTXCCK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.02 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze oxovanadium;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxovanadium;propanoic acid?
The IUPAC name of oxovanadium;propanoic acid (CID 174579609) is oxovanadium;propanoic acid.
What is the SMILES notation for oxovanadium;propanoic acid?
The canonical SMILES for oxovanadium;propanoic acid is CCC(=O)O.O=[V].
What is the InChIKey of oxovanadium;propanoic acid?
The InChIKey is WILNATAGHTXCCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.O.V/c1-2-3(4)5;;/h2H2,1H3,(H,4,5);;.
What are the key properties of oxovanadium;propanoic acid?
oxovanadium;propanoic acid has a molecular weight of 141.02 g/mol, XLogP of 0.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxovanadium;propanoic acid is sourced from PubChem (CID 174579609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).