oxovanadium;propanoic acid

C3H6O3V — CID 174579609

IUPACoxovanadium;propanoic acid
SMILESCCC(=O)O.O=[V]
InChIInChI=1S/C3H6O2.O.V/c1-2-3(4)5;;/h2H2,1H3,(H,4,5);;
InChIKeyWILNATAGHTXCCK-UHFFFAOYSA-N
MW141.02 g/mol
LogP0.36
Rot. Bonds1

About oxovanadium;propanoic acid

oxovanadium;propanoic acid (PubChem CID 174579609) has the molecular formula C3H6O3V and a molecular weight of 141.02 g/mol. Its IUPAC name is oxovanadium;propanoic acid.

Molecular Properties

Compound Nameoxovanadium;propanoic acid
PubChem CID174579609
Molecular FormulaC3H6O3V
Molecular Weight141.02 g/mol
Exact Mass140.98
IUPAC Nameoxovanadium;propanoic acid
SMILESCCC(=O)O.O=[V]
InChIInChI=1S/C3H6O2.O.V/c1-2-3(4)5;;/h2H2,1H3,(H,4,5);;
InChIKeyWILNATAGHTXCCK-UHFFFAOYSA-N
XLogP0.36
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.02
LogP ≤ 50.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze oxovanadium;propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of oxovanadium;propanoic acid?
The IUPAC name of oxovanadium;propanoic acid (CID 174579609) is oxovanadium;propanoic acid.
What is the SMILES notation for oxovanadium;propanoic acid?
The canonical SMILES for oxovanadium;propanoic acid is CCC(=O)O.O=[V].
What is the InChIKey of oxovanadium;propanoic acid?
The InChIKey is WILNATAGHTXCCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.O.V/c1-2-3(4)5;;/h2H2,1H3,(H,4,5);;.
What are the key properties of oxovanadium;propanoic acid?
oxovanadium;propanoic acid has a molecular weight of 141.02 g/mol, XLogP of 0.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxovanadium;propanoic acid is sourced from PubChem (CID 174579609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).