C16H16INO — CID 174580102
3-[4-iodo-4-(methylamino)cyclohexa-1,5-dien-1-yl]-1-phenylprop-2-en-1-one (PubChem CID 174580102) has the molecular formula C16H16INO and a molecular weight of 365.21 g/mol. Its IUPAC name is 3-[4-iodo-4-(methylamino)cyclohexa-1,5-dien-1-yl]-1-phenylprop-2-en-1-one.
| Compound Name | 3-[4-iodo-4-(methylamino)cyclohexa-1,5-dien-1-yl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 174580102 |
| Molecular Formula | C16H16INO |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 3-[4-iodo-4-(methylamino)cyclohexa-1,5-dien-1-yl]-1-phenylprop-2-en-1-one |
| SMILES | CNC1(I)C=CC(C=CC(=O)c2ccccc2)=CC1 |
| InChI | InChI=1S/C16H16INO/c1-18-16(17)11-9-13(10-12-16)7-8-15(19)14-5-3-2-4-6-14/h2-11,18H,12H2,1H3 |
| InChIKey | JFEFEGYSIZURCN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|