C18H20N2O — CID 174583708
N-[(3S)-1-methylpyrrolidin-3-yl]oxy-1,1-diphenylmethanimine (PubChem CID 174583708) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is N-[(3S)-1-methylpyrrolidin-3-yl]oxy-1,1-diphenylmethanimine.
| Compound Name | N-[(3S)-1-methylpyrrolidin-3-yl]oxy-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 174583708 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-[(3S)-1-methylpyrrolidin-3-yl]oxy-1,1-diphenylmethanimine |
| SMILES | CN1CC[C@H](ON=C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C18H20N2O/c1-20-13-12-17(14-20)21-19-18(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,17H,12-14H2,1H3/t17-/m0/s1 |
| InChIKey | MZZPCITVQSJAMT-KRWDZBQOSA-N |
| XLogP | 3.16 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|