About (1-methylpiperidin-4-yl) N-(4-methylphenyl)sulfonylbenzenecarboximidate;hydrochloride
(1-methylpiperidin-4-yl) N-(4-methylphenyl)sulfonylbenzenecarboximidate;hydrochloride (PubChem CID 75105051) has the molecular formula C20H25ClN2O3S
and a molecular weight of 408.95 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) N-(4-methylphenyl)sulfonylbenzenecarboximidate;hydrochloride.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) N-(4-methylphenyl)sulfonylbenzenecarboximidate;hydrochloride |
| PubChem CID | 75105051 |
| Molecular Formula | C20H25ClN2O3S |
| Molecular Weight | 408.95 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (1-methylpiperidin-4-yl) N-(4-methylphenyl)sulfonylbenzenecarboximidate;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N=C(OC2CCN(C)CC2)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C20H24N2O3S.ClH/c1-16-8-10-19(11-9-16)26(23,24)21-20(17-6-4-3-5-7-17)25-18-12-14-22(2)15-13-18;/h3-11,18H,12-15H2,1-2H3;1H |
| InChIKey | DNSHCHXVUZONTM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.95 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpiperidin-4-yl) N-(4-methylphenyl)sulfonylbenzenecarboximidate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) N-(4-methylphenyl)sulfonylbenzenecarboximidate;hydrochloride?
The IUPAC name of (1-methylpiperidin-4-yl) N-(4-methylphenyl)sulfonylbenzenecarboximidate;hydrochloride (CID 75105051) is (1-methylpiperidin-4-yl) N-(4-methylphenyl)sulfonylbenzenecarboximidate;hydrochloride.
What is the SMILES notation for (1-methylpiperidin-4-yl) N-(4-methylphenyl)sulfonylbenzenecarboximidate;hydrochloride?
The canonical SMILES for (1-methylpiperidin-4-yl) N-(4-methylphenyl)sulfonylbenzenecarboximidate;hydrochloride is Cc1ccc(S(=O)(=O)N=C(OC2CCN(C)CC2)c2ccccc2)cc1.Cl.
What is the InChIKey of (1-methylpiperidin-4-yl) N-(4-methylphenyl)sulfonylbenzenecarboximidate;hydrochloride?
The InChIKey is DNSHCHXVUZONTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O3S.ClH/c1-16-8-10-19(11-9-16)26(23,24)21-20(17-6-4-3-5-7-17)25-18-12-14-22(2)15-13-18;/h3-11,18H,12-15H2,1-2H3;1H.
What are the key properties of (1-methylpiperidin-4-yl) N-(4-methylphenyl)sulfonylbenzenecarboximidate;hydrochloride?
(1-methylpiperidin-4-yl) N-(4-methylphenyl)sulfonylbenzenecarboximidate;hydrochloride has a molecular weight of 408.95 g/mol, XLogP of 3.66, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) N-(4-methylphenyl)sulfonylbenzenecarboximidate;hydrochloride is sourced from PubChem (CID 75105051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).