C16H19NO2 — CID 174585174
1-[3-(3,4-dihydro-2H-chromen-6-yloxy)propyl]pyrrole (PubChem CID 174585174) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 1-[3-(3,4-dihydro-2H-chromen-6-yloxy)propyl]pyrrole.
| Compound Name | 1-[3-(3,4-dihydro-2H-chromen-6-yloxy)propyl]pyrrole |
|---|---|
| PubChem CID | 174585174 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-[3-(3,4-dihydro-2H-chromen-6-yloxy)propyl]pyrrole |
| SMILES | c1ccn(CCCOc2ccc3c(c2)CCCO3)c1 |
| InChI | InChI=1S/C16H19NO2/c1-2-9-17(8-1)10-4-12-18-15-6-7-16-14(13-15)5-3-11-19-16/h1-2,6-9,13H,3-5,10-12H2 |
| InChIKey | QFRJRTZWLKHKKH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|