C18H24ClN3O3 — CID 174586008
3-[3-(2-methoxyethoxy)-4-pyridin-3-ylphenyl]-2-methylpropanehydrazide;hydrochloride (PubChem CID 174586008) has the molecular formula C18H24ClN3O3 and a molecular weight of 365.86 g/mol. Its IUPAC name is 3-[3-(2-methoxyethoxy)-4-pyridin-3-ylphenyl]-2-methylpropanehydrazide;hydrochloride.
| Compound Name | 3-[3-(2-methoxyethoxy)-4-pyridin-3-ylphenyl]-2-methylpropanehydrazide;hydrochloride |
|---|---|
| PubChem CID | 174586008 |
| Molecular Formula | C18H24ClN3O3 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 3-[3-(2-methoxyethoxy)-4-pyridin-3-ylphenyl]-2-methylpropanehydrazide;hydrochloride |
| SMILES | COCCOc1cc(CC(C)C(=O)NN)ccc1-c1cccnc1.Cl |
| InChI | InChI=1S/C18H23N3O3.ClH/c1-13(18(22)21-19)10-14-5-6-16(15-4-3-7-20-12-15)17(11-14)24-9-8-23-2;/h3-7,11-13H,8-10,19H2,1-2H3,(H,21,22);1H |
| InChIKey | NJPMYQTVCMJVQD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|