C8H18N4O — CID 174586256
1-[2-(2-aminoethylamino)ethyl]imidazolidine-2-carbaldehyde (PubChem CID 174586256) has the molecular formula C8H18N4O and a molecular weight of 186.26 g/mol. Its IUPAC name is 1-[2-(2-aminoethylamino)ethyl]imidazolidine-2-carbaldehyde.
| Compound Name | 1-[2-(2-aminoethylamino)ethyl]imidazolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174586256 |
| Molecular Formula | C8H18N4O |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 1-[2-(2-aminoethylamino)ethyl]imidazolidine-2-carbaldehyde |
| SMILES | NCCNCCN1CCNC1C=O |
| InChI | InChI=1S/C8H18N4O/c9-1-2-10-3-5-12-6-4-11-8(12)7-13/h7-8,10-11H,1-6,9H2 |
| InChIKey | XJGPDVFWBRGTEG-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|