C10H24N4 — CID 10888935
N'-[2-(2,3-dimethylpiperazin-1-yl)ethyl]ethane-1,2-diamine (PubChem CID 10888935) has the molecular formula C10H24N4 and a molecular weight of 200.33 g/mol. Its IUPAC name is N'-[2-(2,3-dimethylpiperazin-1-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(2,3-dimethylpiperazin-1-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 10888935 |
| Molecular Formula | C10H24N4 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.20 |
| IUPAC Name | N'-[2-(2,3-dimethylpiperazin-1-yl)ethyl]ethane-1,2-diamine |
| SMILES | CC1NCCN(CCNCCN)C1C |
| InChI | InChI=1S/C10H24N4/c1-9-10(2)14(8-6-13-9)7-5-12-4-3-11/h9-10,12-13H,3-8,11H2,1-2H3 |
| InChIKey | UAPJQFLBKWMGSJ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|