C25H23F2N3O — CID 174586339
2-fluoro-N-[3-[3-[1-(4-fluorophenyl)indazol-5-yl]phenyl]propyl]propanamide (PubChem CID 174586339) has the molecular formula C25H23F2N3O and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-fluoro-N-[3-[3-[1-(4-fluorophenyl)indazol-5-yl]phenyl]propyl]propanamide.
| Compound Name | 2-fluoro-N-[3-[3-[1-(4-fluorophenyl)indazol-5-yl]phenyl]propyl]propanamide |
|---|---|
| PubChem CID | 174586339 |
| Molecular Formula | C25H23F2N3O |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-fluoro-N-[3-[3-[1-(4-fluorophenyl)indazol-5-yl]phenyl]propyl]propanamide |
| SMILES | CC(F)C(=O)NCCCc1cccc(-c2ccc3c(cnn3-c3ccc(F)cc3)c2)c1 |
| InChI | InChI=1S/C25H23F2N3O/c1-17(26)25(31)28-13-3-5-18-4-2-6-19(14-18)20-7-12-24-21(15-20)16-29-30(24)23-10-8-22(27)9-11-23/h2,4,6-12,14-17H,3,5,13H2,1H3,(H,28,31) |
| InChIKey | IBKUKDDFKHKMNV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|