C19H27NO2 — CID 174590366
6-[(5R)-4-imino-5-methylheptoxy]-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde (PubChem CID 174590366) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 6-[(5R)-4-imino-5-methylheptoxy]-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde.
| Compound Name | 6-[(5R)-4-imino-5-methylheptoxy]-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 174590366 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 6-[(5R)-4-imino-5-methylheptoxy]-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde |
| SMILES | [H]/N=C(/CCCOc1ccc2c(c1)CCCC2C=O)[C@H](C)CC |
| InChI | InChI=1S/C19H27NO2/c1-3-14(2)19(20)8-5-11-22-17-9-10-18-15(12-17)6-4-7-16(18)13-21/h9-10,12-14,16,20H,3-8,11H2,1-2H3/b20-19-/t14-,16?/m1/s1 |
| InChIKey | NCJDXCJEHHKDLF-XAINLEIASA-N |
| XLogP | 4.53 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|