C23H30N4O2 — CID 174593052
1-[4-[3-(3,4-dimethoxyphenyl)-2-methyl-2H-imidazol-1-yl]phenyl]-4-methylpiperazine (PubChem CID 174593052) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-[4-[3-(3,4-dimethoxyphenyl)-2-methyl-2H-imidazol-1-yl]phenyl]-4-methylpiperazine.
| Compound Name | 1-[4-[3-(3,4-dimethoxyphenyl)-2-methyl-2H-imidazol-1-yl]phenyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 174593052 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1-[4-[3-(3,4-dimethoxyphenyl)-2-methyl-2H-imidazol-1-yl]phenyl]-4-methylpiperazine |
| SMILES | COc1ccc(N2C=CN(c3ccc(N4CCN(C)CC4)cc3)C2C)cc1OC |
| InChI | InChI=1S/C23H30N4O2/c1-18-26(15-16-27(18)21-9-10-22(28-3)23(17-21)29-4)20-7-5-19(6-8-20)25-13-11-24(2)12-14-25/h5-10,15-18H,11-14H2,1-4H3 |
| InChIKey | JUWJVOBDLPSKJM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 31.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|