C23H27N9O4 — CID 174593234
N-[4-[2,4-bis[amino(carbamoyl)amino]-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]propanamide (PubChem CID 174593234) has the molecular formula C23H27N9O4 and a molecular weight of 493.53 g/mol. Its IUPAC name is N-[4-[2,4-bis[amino(carbamoyl)amino]-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]propanamide.
| Compound Name | N-[4-[2,4-bis[amino(carbamoyl)amino]-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 174593234 |
| Molecular Formula | C23H27N9O4 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | N-[4-[2,4-bis[amino(carbamoyl)amino]-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(-c2c(COCc3ccccc3)nc(N(N)C(N)=O)nc2N(N)C(N)=O)cc1 |
| InChI | InChI=1S/C23H27N9O4/c1-2-18(33)28-16-10-8-15(9-11-16)19-17(13-36-12-14-6-4-3-5-7-14)29-23(32(27)22(25)35)30-20(19)31(26)21(24)34/h3-11H,2,12-13,26-27H2,1H3,(H2,24,34)(H2,25,35)(H,28,33) |
| InChIKey | OMBXZRRVEZQJJV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 208.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|