3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid

C15H11NO2S — CID 174593850

IUPAC3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid
SMILESO=C(O)c1cc2scc(C=Cc3ccccc3)c2[nH]1
InChIInChI=1S/C15H11NO2S/c17-15(18)12-8-13-14(16-12)11(9-19-13)7-6-10-4-2-1-3-5-10/h1-9,16H,(H,17,18)
InChIKeyNRGOAWUNEZPEIY-UHFFFAOYSA-N
MW269.33 g/mol
LogP4.10
Rot. Bonds3

About 3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid

3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 174593850) has the molecular formula C15H11NO2S and a molecular weight of 269.33 g/mol. Its IUPAC name is 3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid.

Molecular Properties

Compound Name3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid
PubChem CID174593850
Molecular FormulaC15H11NO2S
Molecular Weight269.33 g/mol
Exact Mass269.05
IUPAC Name3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid
SMILESO=C(O)c1cc2scc(C=Cc3ccccc3)c2[nH]1
InChIInChI=1S/C15H11NO2S/c17-15(18)12-8-13-14(16-12)11(9-19-13)7-6-10-4-2-1-3-5-10/h1-9,16H,(H,17,18)
InChIKeyNRGOAWUNEZPEIY-UHFFFAOYSA-N
XLogP4.10
TPSA53.09 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.33
LogP ≤ 54.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (CID 174593850) is 3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is O=C(O)c1cc2scc(C=Cc3ccccc3)c2[nH]1.
What is the InChIKey of 3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is NRGOAWUNEZPEIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO2S/c17-15(18)12-8-13-14(16-12)11(9-19-13)7-6-10-4-2-1-3-5-10/h1-9,16H,(H,17,18).
What are the key properties of 3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 269.33 g/mol, XLogP of 4.10, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 174593850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).