C15H11NO2S — CID 174593850
3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 174593850) has the molecular formula C15H11NO2S and a molecular weight of 269.33 g/mol. Its IUPAC name is 3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid.
| Compound Name | 3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 174593850 |
| Molecular Formula | C15H11NO2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 3-(2-phenylethenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | O=C(O)c1cc2scc(C=Cc3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C15H11NO2S/c17-15(18)12-8-13-14(16-12)11(9-19-13)7-6-10-4-2-1-3-5-10/h1-9,16H,(H,17,18) |
| InChIKey | NRGOAWUNEZPEIY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |