C11H9NS2 — CID 54395958
4-(2-phenylethenyl)-3H-1,3-thiazole-2-thione (PubChem CID 54395958) has the molecular formula C11H9NS2 and a molecular weight of 219.33 g/mol. Its IUPAC name is 4-(2-phenylethenyl)-3H-1,3-thiazole-2-thione.
| Compound Name | 4-(2-phenylethenyl)-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 54395958 |
| Molecular Formula | C11H9NS2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 4-(2-phenylethenyl)-3H-1,3-thiazole-2-thione |
| SMILES | S=c1[nH]c(C=Cc2ccccc2)cs1 |
| InChI | InChI=1S/C11H9NS2/c13-11-12-10(8-14-11)7-6-9-4-2-1-3-5-9/h1-8H,(H,12,13) |
| InChIKey | VJYQXXWMXJCRNG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|