C17H25NO5S2 — CID 174595081
piperidin-2-ylmethyl 1-(4-methylphenyl)prop-2-enylsulfonylmethanesulfonate (PubChem CID 174595081) has the molecular formula C17H25NO5S2 and a molecular weight of 387.52 g/mol. Its IUPAC name is piperidin-2-ylmethyl 1-(4-methylphenyl)prop-2-enylsulfonylmethanesulfonate.
| Compound Name | piperidin-2-ylmethyl 1-(4-methylphenyl)prop-2-enylsulfonylmethanesulfonate |
|---|---|
| PubChem CID | 174595081 |
| Molecular Formula | C17H25NO5S2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | piperidin-2-ylmethyl 1-(4-methylphenyl)prop-2-enylsulfonylmethanesulfonate |
| SMILES | C=CC(c1ccc(C)cc1)S(=O)(=O)CS(=O)(=O)OCC1CCCCN1 |
| InChI | InChI=1S/C17H25NO5S2/c1-3-17(15-9-7-14(2)8-10-15)24(19,20)13-25(21,22)23-12-16-6-4-5-11-18-16/h3,7-10,16-18H,1,4-6,11-13H2,2H3 |
| InChIKey | UOBVYEMVVIGEDE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|