C18H25NO4S — CID 175377371
2-[4-[1-(4-methylphenyl)prop-2-enylsulfonyl]piperidin-4-yl]ethyl formate (PubChem CID 175377371) has the molecular formula C18H25NO4S and a molecular weight of 351.47 g/mol. Its IUPAC name is 2-[4-[1-(4-methylphenyl)prop-2-enylsulfonyl]piperidin-4-yl]ethyl formate.
| Compound Name | 2-[4-[1-(4-methylphenyl)prop-2-enylsulfonyl]piperidin-4-yl]ethyl formate |
|---|---|
| PubChem CID | 175377371 |
| Molecular Formula | C18H25NO4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 2-[4-[1-(4-methylphenyl)prop-2-enylsulfonyl]piperidin-4-yl]ethyl formate |
| SMILES | C=CC(c1ccc(C)cc1)S(=O)(=O)C1(CCOC=O)CCNCC1 |
| InChI | InChI=1S/C18H25NO4S/c1-3-17(16-6-4-15(2)5-7-16)24(21,22)18(10-13-23-14-20)8-11-19-12-9-18/h3-7,14,17,19H,1,8-13H2,2H3 |
| InChIKey | BJQPYJZOFWZXDU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|