C17H27NO4S — CID 174966980
4-benzylsulfonylpiperidine;tert-butyl formate (PubChem CID 174966980) has the molecular formula C17H27NO4S and a molecular weight of 341.47 g/mol. Its IUPAC name is 4-benzylsulfonylpiperidine;tert-butyl formate.
| Compound Name | 4-benzylsulfonylpiperidine;tert-butyl formate |
|---|---|
| PubChem CID | 174966980 |
| Molecular Formula | C17H27NO4S |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 4-benzylsulfonylpiperidine;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.O=S(=O)(Cc1ccccc1)C1CCNCC1 |
| InChI | InChI=1S/C12H17NO2S.C5H10O2/c14-16(15,12-6-8-13-9-7-12)10-11-4-2-1-3-5-11;1-5(2,3)7-4-6/h1-5,12-13H,6-10H2;4H,1-3H3 |
| InChIKey | ZGUQBSWDFZFIJV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|