C23H33N7O — CID 174595762
6-amino-2-(butylamino)-9-[[4-(piperidin-1-ylmethyl)phenyl]methyl]-7,8-dihydropurine-8-carbaldehyde (PubChem CID 174595762) has the molecular formula C23H33N7O and a molecular weight of 423.57 g/mol. Its IUPAC name is 6-amino-2-(butylamino)-9-[[4-(piperidin-1-ylmethyl)phenyl]methyl]-7,8-dihydropurine-8-carbaldehyde.
| Compound Name | 6-amino-2-(butylamino)-9-[[4-(piperidin-1-ylmethyl)phenyl]methyl]-7,8-dihydropurine-8-carbaldehyde |
|---|---|
| PubChem CID | 174595762 |
| Molecular Formula | C23H33N7O |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 6-amino-2-(butylamino)-9-[[4-(piperidin-1-ylmethyl)phenyl]methyl]-7,8-dihydropurine-8-carbaldehyde |
| SMILES | CCCCNc1nc(N)c2c(n1)N(Cc1ccc(CN3CCCCC3)cc1)C(C=O)N2 |
| InChI | InChI=1S/C23H33N7O/c1-2-3-11-25-23-27-21(24)20-22(28-23)30(19(16-31)26-20)15-18-9-7-17(8-10-18)14-29-12-5-4-6-13-29/h7-10,16,19,26H,2-6,11-15H2,1H3,(H3,24,25,27,28) |
| InChIKey | ADPAITZZLUUZMY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|