C22H40N8O — CID 175271306
6-amino-2-(butylamino)-9-[4-(4-butylpiperazin-1-yl)butyl]-7,8-dihydropurine-8-carbaldehyde (PubChem CID 175271306) has the molecular formula C22H40N8O and a molecular weight of 432.62 g/mol. Its IUPAC name is 6-amino-2-(butylamino)-9-[4-(4-butylpiperazin-1-yl)butyl]-7,8-dihydropurine-8-carbaldehyde.
| Compound Name | 6-amino-2-(butylamino)-9-[4-(4-butylpiperazin-1-yl)butyl]-7,8-dihydropurine-8-carbaldehyde |
|---|---|
| PubChem CID | 175271306 |
| Molecular Formula | C22H40N8O |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.33 |
| IUPAC Name | 6-amino-2-(butylamino)-9-[4-(4-butylpiperazin-1-yl)butyl]-7,8-dihydropurine-8-carbaldehyde |
| SMILES | CCCCNc1nc(N)c2c(n1)N(CCCCN1CCN(CCCC)CC1)C(C=O)N2 |
| InChI | InChI=1S/C22H40N8O/c1-3-5-9-24-22-26-20(23)19-21(27-22)30(18(17-31)25-19)12-8-7-11-29-15-13-28(14-16-29)10-6-4-2/h17-18,25H,3-16H2,1-2H3,(H3,23,24,26,27) |
| InChIKey | WNUMJGKPNKIISB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|