C15H24N6O — CID 143605774
4-amino-2-(butylamino)-8-[(E)-2-methylbut-2-enyl]-5,7-dihydropteridin-6-one (PubChem CID 143605774) has the molecular formula C15H24N6O and a molecular weight of 304.40 g/mol. Its IUPAC name is 4-amino-2-(butylamino)-8-[(E)-2-methylbut-2-enyl]-5,7-dihydropteridin-6-one.
| Compound Name | 4-amino-2-(butylamino)-8-[(E)-2-methylbut-2-enyl]-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 143605774 |
| Molecular Formula | C15H24N6O |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 4-amino-2-(butylamino)-8-[(E)-2-methylbut-2-enyl]-5,7-dihydropteridin-6-one |
| SMILES | C/C=C(\C)CN1CC(=O)Nc2c(N)nc(NCCCC)nc21 |
| InChI | InChI=1S/C15H24N6O/c1-4-6-7-17-15-19-13(16)12-14(20-15)21(8-10(3)5-2)9-11(22)18-12/h5H,4,6-9H2,1-3H3,(H,18,22)(H3,16,17,19,20)/b10-5+ |
| InChIKey | SSKLXTZOEPRVEB-BJMVGYQFSA-N |
| XLogP | 2.00 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|