C21H33N6O2P — CID 143605772
4-amino-2-(butylamino)-8-[(E)-2-methylbut-2-enyl]-5,7-dihydropteridin-6-one;methyl(2-methylidenebut-3-ynyl)phosphinous acid (PubChem CID 143605772) has the molecular formula C21H33N6O2P and a molecular weight of 432.51 g/mol. Its IUPAC name is 4-amino-2-(butylamino)-8-[(E)-2-methylbut-2-enyl]-5,7-dihydropteridin-6-one;methyl(2-methylidenebut-3-ynyl)phosphinous acid.
| Compound Name | 4-amino-2-(butylamino)-8-[(E)-2-methylbut-2-enyl]-5,7-dihydropteridin-6-one;methyl(2-methylidenebut-3-ynyl)phosphinous acid |
|---|---|
| PubChem CID | 143605772 |
| Molecular Formula | C21H33N6O2P |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 4-amino-2-(butylamino)-8-[(E)-2-methylbut-2-enyl]-5,7-dihydropteridin-6-one;methyl(2-methylidenebut-3-ynyl)phosphinous acid |
| SMILES | C#CC(=C)CP(C)O.C/C=C(\C)CN1CC(=O)Nc2c(N)nc(NCCCC)nc21 |
| InChI | InChI=1S/C15H24N6O.C6H9OP/c1-4-6-7-17-15-19-13(16)12-14(20-15)21(8-10(3)5-2)9-11(22)18-12;1-4-6(2)5-8(3)7/h5H,4,6-9H2,1-3H3,(H,18,22)(H3,16,17,19,20);1,7H,2,5H2,3H3/b10-5+; |
| InChIKey | AFINBMDBOBQYSM-OAZHBLANSA-N |
| XLogP | 3.19 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|