C18H18N4O8 — CID 174596966
bis(2-amino-6-carbamoylphenyl) 2,3-dihydroxybutanedioate (PubChem CID 174596966) has the molecular formula C18H18N4O8 and a molecular weight of 418.36 g/mol. Its IUPAC name is bis(2-amino-6-carbamoylphenyl) 2,3-dihydroxybutanedioate.
| Compound Name | bis(2-amino-6-carbamoylphenyl) 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 174596966 |
| Molecular Formula | C18H18N4O8 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | bis(2-amino-6-carbamoylphenyl) 2,3-dihydroxybutanedioate |
| SMILES | NC(=O)c1cccc(N)c1OC(=O)C(O)C(O)C(=O)Oc1c(N)cccc1C(N)=O |
| InChI | InChI=1S/C18H18N4O8/c19-9-5-1-3-7(15(21)25)13(9)29-17(27)11(23)12(24)18(28)30-14-8(16(22)26)4-2-6-10(14)20/h1-6,11-12,23-24H,19-20H2,(H2,21,25)(H2,22,26) |
| InChIKey | UUQASVBKOMOJHN-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 231.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|