C22H18N4O8 — CID 67634758
bis(7-carbamoyl-1H-indol-3-yl) 2,3-dihydroxybutanedioate (PubChem CID 67634758) has the molecular formula C22H18N4O8 and a molecular weight of 466.41 g/mol. Its IUPAC name is bis(7-carbamoyl-1H-indol-3-yl) 2,3-dihydroxybutanedioate.
| Compound Name | bis(7-carbamoyl-1H-indol-3-yl) 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 67634758 |
| Molecular Formula | C22H18N4O8 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | bis(7-carbamoyl-1H-indol-3-yl) 2,3-dihydroxybutanedioate |
| SMILES | NC(=O)c1cccc2c(OC(=O)C(O)C(O)C(=O)Oc3c[nH]c4c(C(N)=O)cccc34)c[nH]c12 |
| InChI | InChI=1S/C22H18N4O8/c23-19(29)11-5-1-3-9-13(7-25-15(9)11)33-21(31)17(27)18(28)22(32)34-14-8-26-16-10(14)4-2-6-12(16)20(24)30/h1-8,17-18,25-28H,(H2,23,29)(H2,24,30) |
| InChIKey | XFNZGEOTLJYCFB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 210.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |