About (4-methoxybenzoyl) 3-carbamoyl-1H-indole-7-carboxylate
(4-methoxybenzoyl) 3-carbamoyl-1H-indole-7-carboxylate (PubChem CID 175235931) has the molecular formula C18H14N2O5
and a molecular weight of 338.32 g/mol. Its IUPAC name is (4-methoxybenzoyl) 3-carbamoyl-1H-indole-7-carboxylate.
Molecular Properties
| Compound Name | (4-methoxybenzoyl) 3-carbamoyl-1H-indole-7-carboxylate |
| PubChem CID | 175235931 |
| Molecular Formula | C18H14N2O5 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (4-methoxybenzoyl) 3-carbamoyl-1H-indole-7-carboxylate |
| SMILES | COc1ccc(C(=O)OC(=O)c2cccc3c(C(N)=O)c[nH]c23)cc1 |
| InChI | InChI=1S/C18H14N2O5/c1-24-11-7-5-10(6-8-11)17(22)25-18(23)13-4-2-3-12-14(16(19)21)9-20-15(12)13/h2-9,20H,1H3,(H2,19,21) |
| InChIKey | WFMXLBFESIVKCO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 111.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxybenzoyl) 3-carbamoyl-1H-indole-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxybenzoyl) 3-carbamoyl-1H-indole-7-carboxylate?
The IUPAC name of (4-methoxybenzoyl) 3-carbamoyl-1H-indole-7-carboxylate (CID 175235931) is (4-methoxybenzoyl) 3-carbamoyl-1H-indole-7-carboxylate.
What is the SMILES notation for (4-methoxybenzoyl) 3-carbamoyl-1H-indole-7-carboxylate?
The canonical SMILES for (4-methoxybenzoyl) 3-carbamoyl-1H-indole-7-carboxylate is COc1ccc(C(=O)OC(=O)c2cccc3c(C(N)=O)c[nH]c23)cc1.
What is the InChIKey of (4-methoxybenzoyl) 3-carbamoyl-1H-indole-7-carboxylate?
The InChIKey is WFMXLBFESIVKCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O5/c1-24-11-7-5-10(6-8-11)17(22)25-18(23)13-4-2-3-12-14(16(19)21)9-20-15(12)13/h2-9,20H,1H3,(H2,19,21).
What are the key properties of (4-methoxybenzoyl) 3-carbamoyl-1H-indole-7-carboxylate?
(4-methoxybenzoyl) 3-carbamoyl-1H-indole-7-carboxylate has a molecular weight of 338.32 g/mol, XLogP of 2.27, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxybenzoyl) 3-carbamoyl-1H-indole-7-carboxylate is sourced from PubChem (CID 175235931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).