C17H31ClN2O3Si — CID 174598826
N'-[(4-ethenylphenyl)methyl]-N'-(1,2,2-trimethoxy-1-silylpropyl)ethane-1,2-diamine;hydrochloride (PubChem CID 174598826) has the molecular formula C17H31ClN2O3Si and a molecular weight of 374.99 g/mol. Its IUPAC name is N'-[(4-ethenylphenyl)methyl]-N'-(1,2,2-trimethoxy-1-silylpropyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | N'-[(4-ethenylphenyl)methyl]-N'-(1,2,2-trimethoxy-1-silylpropyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 174598826 |
| Molecular Formula | C17H31ClN2O3Si |
| Molecular Weight | 374.99 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N'-[(4-ethenylphenyl)methyl]-N'-(1,2,2-trimethoxy-1-silylpropyl)ethane-1,2-diamine;hydrochloride |
| SMILES | C=Cc1ccc(CN(CCN)C([SiH3])(OC)C(C)(OC)OC)cc1.Cl |
| InChI | InChI=1S/C17H30N2O3Si.ClH/c1-6-14-7-9-15(10-8-14)13-19(12-11-18)17(23,22-5)16(2,20-3)21-4;/h6-10H,1,11-13,18H2,2-5,23H3;1H |
| InChIKey | FSDSQKNIOMCKTK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.99 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|