C15H17FN4O3 — CID 174600122
2-[amino(formyl)amino]-5-(5-fluoro-2-propoxyphenyl)-1H-pyrrole-3-carboxamide (PubChem CID 174600122) has the molecular formula C15H17FN4O3 and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-[amino(formyl)amino]-5-(5-fluoro-2-propoxyphenyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 2-[amino(formyl)amino]-5-(5-fluoro-2-propoxyphenyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 174600122 |
| Molecular Formula | C15H17FN4O3 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-[amino(formyl)amino]-5-(5-fluoro-2-propoxyphenyl)-1H-pyrrole-3-carboxamide |
| SMILES | CCCOc1ccc(F)cc1-c1cc(C(N)=O)c(N(N)C=O)[nH]1 |
| InChI | InChI=1S/C15H17FN4O3/c1-2-5-23-13-4-3-9(16)6-10(13)12-7-11(14(17)22)15(19-12)20(18)8-21/h3-4,6-8,19H,2,5,18H2,1H3,(H2,17,22) |
| InChIKey | XOXLTCVGIBVESL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|