C17H24FN7 — CID 174600529
1-[4-(4-butanimidoylpiperidin-1-yl)-3-fluorophenyl]-1,2,4-triazole-3,5-diamine (PubChem CID 174600529) has the molecular formula C17H24FN7 and a molecular weight of 345.43 g/mol. Its IUPAC name is 1-[4-(4-butanimidoylpiperidin-1-yl)-3-fluorophenyl]-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-[4-(4-butanimidoylpiperidin-1-yl)-3-fluorophenyl]-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 174600529 |
| Molecular Formula | C17H24FN7 |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 1-[4-(4-butanimidoylpiperidin-1-yl)-3-fluorophenyl]-1,2,4-triazole-3,5-diamine |
| SMILES | [H]/N=C(\CCC)C1CCN(c2ccc(-n3nc(N)nc3N)cc2F)CC1 |
| InChI | InChI=1S/C17H24FN7/c1-2-3-14(19)11-6-8-24(9-7-11)15-5-4-12(10-13(15)18)25-17(21)22-16(20)23-25/h4-5,10-11,19H,2-3,6-9H2,1H3,(H4,20,21,22,23)/b19-14+ |
| InChIKey | ABQAMGXUBWJTLS-XMHGGMMESA-N |
| XLogP | 2.61 |
| TPSA | 109.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|