C19H28FN7 — CID 66694821
1-[3-fluoro-4-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]phenyl]-1,2,4-triazole-3,5-diamine (PubChem CID 66694821) has the molecular formula C19H28FN7 and a molecular weight of 373.48 g/mol. Its IUPAC name is 1-[3-fluoro-4-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]phenyl]-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-[3-fluoro-4-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]phenyl]-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 66694821 |
| Molecular Formula | C19H28FN7 |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 1-[3-fluoro-4-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]phenyl]-1,2,4-triazole-3,5-diamine |
| SMILES | CN1CCC(C2CCN(c3ccc(-n4nc(N)nc4N)cc3F)CC2)CC1 |
| InChI | InChI=1S/C19H28FN7/c1-25-8-4-13(5-9-25)14-6-10-26(11-7-14)17-3-2-15(12-16(17)20)27-19(22)23-18(21)24-27/h2-3,12-14H,4-11H2,1H3,(H4,21,22,23,24) |
| InChIKey | SWHCNWNLZCEHRB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|