C29H34FN3O2 — CID 174602206
4-[2-[(2R)-4-cyclobutyl-4-iminobutan-2-yl]-1-oxo-3,4-dihydroisoquinolin-6-yl]-N-cyclopentyl-3-fluorobenzamide (PubChem CID 174602206) has the molecular formula C29H34FN3O2 and a molecular weight of 475.61 g/mol. Its IUPAC name is 4-[2-[(2R)-4-cyclobutyl-4-iminobutan-2-yl]-1-oxo-3,4-dihydroisoquinolin-6-yl]-N-cyclopentyl-3-fluorobenzamide.
| Compound Name | 4-[2-[(2R)-4-cyclobutyl-4-iminobutan-2-yl]-1-oxo-3,4-dihydroisoquinolin-6-yl]-N-cyclopentyl-3-fluorobenzamide |
|---|---|
| PubChem CID | 174602206 |
| Molecular Formula | C29H34FN3O2 |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 4-[2-[(2R)-4-cyclobutyl-4-iminobutan-2-yl]-1-oxo-3,4-dihydroisoquinolin-6-yl]-N-cyclopentyl-3-fluorobenzamide |
| SMILES | [H]/N=C(/C[C@@H](C)N1CCc2cc(-c3ccc(C(=O)NC4CCCC4)cc3F)ccc2C1=O)C1CCC1 |
| InChI | InChI=1S/C29H34FN3O2/c1-18(15-27(31)19-5-4-6-19)33-14-13-21-16-20(9-12-25(21)29(33)35)24-11-10-22(17-26(24)30)28(34)32-23-7-2-3-8-23/h9-12,16-19,23,31H,2-8,13-15H2,1H3,(H,32,34)/b31-27-/t18-/m1/s1 |
| InChIKey | IBYGYDIFHLOFBA-RNXZTDICSA-N |
| XLogP | 5.76 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|