C25H28FN3O3 — CID 174603905
(4-fluorophenyl) 3-methyl-1-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]pyrazole-4-carboxylate (PubChem CID 174603905) has the molecular formula C25H28FN3O3 and a molecular weight of 437.52 g/mol. Its IUPAC name is (4-fluorophenyl) 3-methyl-1-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]pyrazole-4-carboxylate.
| Compound Name | (4-fluorophenyl) 3-methyl-1-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 174603905 |
| Molecular Formula | C25H28FN3O3 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | (4-fluorophenyl) 3-methyl-1-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]pyrazole-4-carboxylate |
| SMILES | Cc1nn(-c2ccc(OCCCN3CCCC3C)cc2)cc1C(=O)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C25H28FN3O3/c1-18-5-3-14-28(18)15-4-16-31-22-12-8-21(9-13-22)29-17-24(19(2)27-29)25(30)32-23-10-6-20(26)7-11-23/h6-13,17-18H,3-5,14-16H2,1-2H3 |
| InChIKey | LJMQEXHRCWYVRI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|