C25H36N4O3 — CID 67416121
[5-methyl-2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]pyrazol-3-yl] N-cyclohexylcarbamate (PubChem CID 67416121) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is [5-methyl-2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]pyrazol-3-yl] N-cyclohexylcarbamate.
| Compound Name | [5-methyl-2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]pyrazol-3-yl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 67416121 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | [5-methyl-2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]pyrazol-3-yl] N-cyclohexylcarbamate |
| SMILES | Cc1cc(OC(=O)NC2CCCCC2)n(-c2ccc(OCCCN3CCC[C@H]3C)cc2)n1 |
| InChI | InChI=1S/C25H36N4O3/c1-19-18-24(32-25(30)26-21-9-4-3-5-10-21)29(27-19)22-11-13-23(14-12-22)31-17-7-16-28-15-6-8-20(28)2/h11-14,18,20-21H,3-10,15-17H2,1-2H3,(H,26,30)/t20-/m1/s1 |
| InChIKey | HJDNTDNVUDDIOE-HXUWFJFHSA-N |
| XLogP | 4.86 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|