C25H36N4O2 — CID 24783028
N-cyclohexyl-5-methyl-2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]pyrazole-3-carboxamide (PubChem CID 24783028) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-cyclohexyl-5-methyl-2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]pyrazole-3-carboxamide.
| Compound Name | N-cyclohexyl-5-methyl-2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 24783028 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | N-cyclohexyl-5-methyl-2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCCCC2)n(-c2ccc(OCCCN3CCC[C@H]3C)cc2)n1 |
| InChI | InChI=1S/C25H36N4O2/c1-19-18-24(25(30)26-21-9-4-3-5-10-21)29(27-19)22-11-13-23(14-12-22)31-17-7-16-28-15-6-8-20(28)2/h11-14,18,20-21H,3-10,15-17H2,1-2H3,(H,26,30)/t20-/m1/s1 |
| InChIKey | WVYVWKPFJBUUAE-HXUWFJFHSA-N |
| XLogP | 4.50 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|