C28H19F3N2O2S — CID 174605463
4-(2-methylsulfonyl-3-phenylphenyl)-2-phenyl-8-(trifluoromethyl)quinazoline (PubChem CID 174605463) has the molecular formula C28H19F3N2O2S and a molecular weight of 504.53 g/mol. Its IUPAC name is 4-(2-methylsulfonyl-3-phenylphenyl)-2-phenyl-8-(trifluoromethyl)quinazoline.
| Compound Name | 4-(2-methylsulfonyl-3-phenylphenyl)-2-phenyl-8-(trifluoromethyl)quinazoline |
|---|---|
| PubChem CID | 174605463 |
| Molecular Formula | C28H19F3N2O2S |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 4-(2-methylsulfonyl-3-phenylphenyl)-2-phenyl-8-(trifluoromethyl)quinazoline |
| SMILES | CS(=O)(=O)c1c(-c2ccccc2)cccc1-c1nc(-c2ccccc2)nc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C28H19F3N2O2S/c1-36(34,35)26-20(18-10-4-2-5-11-18)14-8-16-22(26)24-21-15-9-17-23(28(29,30)31)25(21)33-27(32-24)19-12-6-3-7-13-19/h2-17H,1H3 |
| InChIKey | WRAVHLYSNKVSOQ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |