C27H28F3NO3 — CID 174607844
2-[2-(ethylaminomethyl)-3-phenyl-4-phenylmethoxy-6-(trifluoromethyl)phenyl]ethyl acetate (PubChem CID 174607844) has the molecular formula C27H28F3NO3 and a molecular weight of 471.52 g/mol. Its IUPAC name is 2-[2-(ethylaminomethyl)-3-phenyl-4-phenylmethoxy-6-(trifluoromethyl)phenyl]ethyl acetate.
| Compound Name | 2-[2-(ethylaminomethyl)-3-phenyl-4-phenylmethoxy-6-(trifluoromethyl)phenyl]ethyl acetate |
|---|---|
| PubChem CID | 174607844 |
| Molecular Formula | C27H28F3NO3 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 2-[2-(ethylaminomethyl)-3-phenyl-4-phenylmethoxy-6-(trifluoromethyl)phenyl]ethyl acetate |
| SMILES | CCNCc1c(CCOC(C)=O)c(C(F)(F)F)cc(OCc2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C27H28F3NO3/c1-3-31-17-23-22(14-15-33-19(2)32)24(27(28,29)30)16-25(26(23)21-12-8-5-9-13-21)34-18-20-10-6-4-7-11-20/h4-13,16,31H,3,14-15,17-18H2,1-2H3 |
| InChIKey | HLCPDBZSBROTMF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |