C24H24N2O6 — CID 174609105
[7-ethynyl-2,2-dimethyl-3-oxo-4-[2-(phenylmethoxycarbonylamino)ethyl]-1,4-benzoxazin-6-yl] acetate (PubChem CID 174609105) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is [7-ethynyl-2,2-dimethyl-3-oxo-4-[2-(phenylmethoxycarbonylamino)ethyl]-1,4-benzoxazin-6-yl] acetate.
| Compound Name | [7-ethynyl-2,2-dimethyl-3-oxo-4-[2-(phenylmethoxycarbonylamino)ethyl]-1,4-benzoxazin-6-yl] acetate |
|---|---|
| PubChem CID | 174609105 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | [7-ethynyl-2,2-dimethyl-3-oxo-4-[2-(phenylmethoxycarbonylamino)ethyl]-1,4-benzoxazin-6-yl] acetate |
| SMILES | C#Cc1cc2c(cc1OC(C)=O)N(CCNC(=O)OCc1ccccc1)C(=O)C(C)(C)O2 |
| InChI | InChI=1S/C24H24N2O6/c1-5-18-13-21-19(14-20(18)31-16(2)27)26(22(28)24(3,4)32-21)12-11-25-23(29)30-15-17-9-7-6-8-10-17/h1,6-10,13-14H,11-12,15H2,2-4H3,(H,25,29) |
| InChIKey | DRPRGCSNLNFOHR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|