C23H21N3O2 — CID 174610499
[3-(3,4,5,6-tetrahydrochrysen-1-yl)oxazin-2-yl]urea (PubChem CID 174610499) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is [3-(3,4,5,6-tetrahydrochrysen-1-yl)oxazin-2-yl]urea.
| Compound Name | [3-(3,4,5,6-tetrahydrochrysen-1-yl)oxazin-2-yl]urea |
|---|---|
| PubChem CID | 174610499 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | [3-(3,4,5,6-tetrahydrochrysen-1-yl)oxazin-2-yl]urea |
| SMILES | NC(=O)NN1OC=CC=C1C1=CCCc2c1ccc1c2CCc2ccccc2-1 |
| InChI | InChI=1S/C23H21N3O2/c24-23(27)25-26-22(9-4-14-28-26)21-8-3-7-17-19-11-10-15-5-1-2-6-16(15)18(19)12-13-20(17)21/h1-2,4-6,8-9,12-14H,3,7,10-11H2,(H3,24,25,27) |
| InChIKey | CKNJPAZKZMKVEV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |