C26H22 — CID 174858188
pentalene;2,3,5,6-tetrahydrochrysene (PubChem CID 174858188) has the molecular formula C26H22 and a molecular weight of 334.46 g/mol. Its IUPAC name is pentalene;2,3,5,6-tetrahydrochrysene.
| Compound Name | pentalene;2,3,5,6-tetrahydrochrysene |
|---|---|
| PubChem CID | 174858188 |
| Molecular Formula | C26H22 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | pentalene;2,3,5,6-tetrahydrochrysene |
| SMILES | C1=CC2=CC=CC2=C1.C1=c2ccc3c(c2=CCC1)CCc1ccccc1-3 |
| InChI | InChI=1S/C18H16.C8H6/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-3-7-5-2-6-8(7)4-1/h1,3,5-8,10,12H,2,4,9,11H2;1-6H |
| InChIKey | QZGBEORKLHAGGQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |