C17H19FN4O — CID 174611916
7-(4-fluorophenyl)-5-(methoxyiminomethyl)-4-methyl-5,6,7,8-tetrahydroquinazolin-2-amine (PubChem CID 174611916) has the molecular formula C17H19FN4O and a molecular weight of 314.36 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-5-(methoxyiminomethyl)-4-methyl-5,6,7,8-tetrahydroquinazolin-2-amine.
| Compound Name | 7-(4-fluorophenyl)-5-(methoxyiminomethyl)-4-methyl-5,6,7,8-tetrahydroquinazolin-2-amine |
|---|---|
| PubChem CID | 174611916 |
| Molecular Formula | C17H19FN4O |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 7-(4-fluorophenyl)-5-(methoxyiminomethyl)-4-methyl-5,6,7,8-tetrahydroquinazolin-2-amine |
| SMILES | CON=CC1CC(c2ccc(F)cc2)Cc2nc(N)nc(C)c21 |
| InChI | InChI=1S/C17H19FN4O/c1-10-16-13(9-20-23-2)7-12(8-15(16)22-17(19)21-10)11-3-5-14(18)6-4-11/h3-6,9,12-13H,7-8H2,1-2H3,(H2,19,21,22) |
| InChIKey | STQDELZSSIEULB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|