C16H17ClN4O — CID 174596613
7-(4-chlorophenyl)-5-(methoxyiminomethyl)-5,6,7,8-tetrahydroquinazolin-2-amine (PubChem CID 174596613) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-5-(methoxyiminomethyl)-5,6,7,8-tetrahydroquinazolin-2-amine.
| Compound Name | 7-(4-chlorophenyl)-5-(methoxyiminomethyl)-5,6,7,8-tetrahydroquinazolin-2-amine |
|---|---|
| PubChem CID | 174596613 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 7-(4-chlorophenyl)-5-(methoxyiminomethyl)-5,6,7,8-tetrahydroquinazolin-2-amine |
| SMILES | CON=CC1CC(c2ccc(Cl)cc2)Cc2nc(N)ncc21 |
| InChI | InChI=1S/C16H17ClN4O/c1-22-20-8-12-6-11(10-2-4-13(17)5-3-10)7-15-14(12)9-19-16(18)21-15/h2-5,8-9,11-12H,6-7H2,1H3,(H2,18,19,21) |
| InChIKey | JSUPWDUXERLZIW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|