C11H16N4O — CID 174707618
N-[(2-amino-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-yl)methylidene]hydroxylamine (PubChem CID 174707618) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is N-[(2-amino-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-yl)methylidene]hydroxylamine.
| Compound Name | N-[(2-amino-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 174707618 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | N-[(2-amino-7,7-dimethyl-6,8-dihydro-5H-quinazolin-5-yl)methylidene]hydroxylamine |
| SMILES | CC1(C)Cc2nc(N)ncc2C(C=NO)C1 |
| InChI | InChI=1S/C11H16N4O/c1-11(2)3-7(5-14-16)8-6-13-10(12)15-9(8)4-11/h5-7,16H,3-4H2,1-2H3,(H2,12,13,15) |
| InChIKey | RBPKCFMVCXCZFC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|