C28H30N4O — CID 174612465
6-(3,5-dimethylphenyl)-8-(4-piperidin-4-ylanilino)-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde (PubChem CID 174612465) has the molecular formula C28H30N4O and a molecular weight of 438.58 g/mol. Its IUPAC name is 6-(3,5-dimethylphenyl)-8-(4-piperidin-4-ylanilino)-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde.
| Compound Name | 6-(3,5-dimethylphenyl)-8-(4-piperidin-4-ylanilino)-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 174612465 |
| Molecular Formula | C28H30N4O |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 6-(3,5-dimethylphenyl)-8-(4-piperidin-4-ylanilino)-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde |
| SMILES | Cc1cc(C)cc(-c2cc3c(c(Nc4ccc(C5CCNCC5)cc4)n2)C(C=O)NC=C3)c1 |
| InChI | InChI=1S/C28H30N4O/c1-18-13-19(2)15-23(14-18)25-16-22-9-12-30-26(17-33)27(22)28(32-25)31-24-5-3-20(4-6-24)21-7-10-29-11-8-21/h3-6,9,12-17,21,26,29-30H,7-8,10-11H2,1-2H3,(H,31,32) |
| InChIKey | LUEKXYIOQXMVBR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|