C9H17IN2O2 — CID 174613294
4-(3-ethenyl-2H-imidazol-1-yl)butane-1,2-diol;hydroiodide (PubChem CID 174613294) has the molecular formula C9H17IN2O2 and a molecular weight of 312.15 g/mol. Its IUPAC name is 4-(3-ethenyl-2H-imidazol-1-yl)butane-1,2-diol;hydroiodide.
| Compound Name | 4-(3-ethenyl-2H-imidazol-1-yl)butane-1,2-diol;hydroiodide |
|---|---|
| PubChem CID | 174613294 |
| Molecular Formula | C9H17IN2O2 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 4-(3-ethenyl-2H-imidazol-1-yl)butane-1,2-diol;hydroiodide |
| SMILES | C=CN1C=CN(CCC(O)CO)C1.I |
| InChI | InChI=1S/C9H16N2O2.HI/c1-2-10-5-6-11(8-10)4-3-9(13)7-12;/h2,5-6,9,12-13H,1,3-4,7-8H2;1H |
| InChIKey | KQEXOAHBURUJBT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|