About 2-(3-ethenyl-2H-imidazol-1-yl)acetic acid;hexafluoroantimony(1-)
2-(3-ethenyl-2H-imidazol-1-yl)acetic acid;hexafluoroantimony(1-) (PubChem CID 175560038) has the molecular formula C7H10F6N2O2Sb-
and a molecular weight of 389.92 g/mol. Its IUPAC name is 2-(3-ethenyl-2H-imidazol-1-yl)acetic acid;hexafluoroantimony(1-).
Molecular Properties
| Compound Name | 2-(3-ethenyl-2H-imidazol-1-yl)acetic acid;hexafluoroantimony(1-) |
| PubChem CID | 175560038 |
| Molecular Formula | C7H10F6N2O2Sb- |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | 2-(3-ethenyl-2H-imidazol-1-yl)acetic acid;hexafluoroantimony(1-) |
| SMILES | C=CN1C=CN(CC(=O)O)C1.F[Sb-](F)(F)(F)(F)F |
| InChI | InChI=1S/C7H10N2O2.6FH.Sb/c1-2-8-3-4-9(6-8)5-7(10)11;;;;;;;/h2-4H,1,5-6H2,(H,10,11);6*1H;/q;;;;;;;+5/p-6 |
| InChIKey | RCSBDSRGKHNYNY-UHFFFAOYSA-H |
| XLogP | 2.40 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethenyl-2H-imidazol-1-yl)acetic acid;hexafluoroantimony(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethenyl-2H-imidazol-1-yl)acetic acid;hexafluoroantimony(1-)?
The IUPAC name of 2-(3-ethenyl-2H-imidazol-1-yl)acetic acid;hexafluoroantimony(1-) (CID 175560038) is 2-(3-ethenyl-2H-imidazol-1-yl)acetic acid;hexafluoroantimony(1-).
What is the SMILES notation for 2-(3-ethenyl-2H-imidazol-1-yl)acetic acid;hexafluoroantimony(1-)?
The canonical SMILES for 2-(3-ethenyl-2H-imidazol-1-yl)acetic acid;hexafluoroantimony(1-) is C=CN1C=CN(CC(=O)O)C1.F[Sb-](F)(F)(F)(F)F.
What is the InChIKey of 2-(3-ethenyl-2H-imidazol-1-yl)acetic acid;hexafluoroantimony(1-)?
The InChIKey is RCSBDSRGKHNYNY-UHFFFAOYSA-H. The full InChI is InChI=1S/C7H10N2O2.6FH.Sb/c1-2-8-3-4-9(6-8)5-7(10)11;;;;;;;/h2-4H,1,5-6H2,(H,10,11);6*1H;/q;;;;;;;+5/p-6.
What are the key properties of 2-(3-ethenyl-2H-imidazol-1-yl)acetic acid;hexafluoroantimony(1-)?
2-(3-ethenyl-2H-imidazol-1-yl)acetic acid;hexafluoroantimony(1-) has a molecular weight of 389.92 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethenyl-2H-imidazol-1-yl)acetic acid;hexafluoroantimony(1-) is sourced from PubChem (CID 175560038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).