C8H14N2O2 — CID 174673019
acetic acid;1-ethenyl-3-methyl-2H-imidazole (PubChem CID 174673019) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is acetic acid;1-ethenyl-3-methyl-2H-imidazole.
| Compound Name | acetic acid;1-ethenyl-3-methyl-2H-imidazole |
|---|---|
| PubChem CID | 174673019 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | acetic acid;1-ethenyl-3-methyl-2H-imidazole |
| SMILES | C=CN1C=CN(C)C1.CC(=O)O |
| InChI | InChI=1S/C6H10N2.C2H4O2/c1-3-8-5-4-7(2)6-8;1-2(3)4/h3-5H,1,6H2,2H3;1H3,(H,3,4) |
| InChIKey | UVQPACCJFWWCEB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |