acetic acid;1-ethenyl-3-methyl-2H-imidazole

C8H14N2O2 — CID 174673019

IUPACacetic acid;1-ethenyl-3-methyl-2H-imidazole
SMILESC=CN1C=CN(C)C1.CC(=O)O
InChIInChI=1S/C6H10N2.C2H4O2/c1-3-8-5-4-7(2)6-8;1-2(3)4/h3-5H,1,6H2,2H3;1H3,(H,3,4)
InChIKeyUVQPACCJFWWCEB-UHFFFAOYSA-N
MW170.21 g/mol
LogP0.90
Rot. Bonds1

About acetic acid;1-ethenyl-3-methyl-2H-imidazole

acetic acid;1-ethenyl-3-methyl-2H-imidazole (PubChem CID 174673019) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is acetic acid;1-ethenyl-3-methyl-2H-imidazole.

Molecular Properties

Compound Nameacetic acid;1-ethenyl-3-methyl-2H-imidazole
PubChem CID174673019
Molecular FormulaC8H14N2O2
Molecular Weight170.21 g/mol
Exact Mass170.11
IUPAC Nameacetic acid;1-ethenyl-3-methyl-2H-imidazole
SMILESC=CN1C=CN(C)C1.CC(=O)O
InChIInChI=1S/C6H10N2.C2H4O2/c1-3-8-5-4-7(2)6-8;1-2(3)4/h3-5H,1,6H2,2H3;1H3,(H,3,4)
InChIKeyUVQPACCJFWWCEB-UHFFFAOYSA-N
XLogP0.90
TPSA43.78 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.21
LogP ≤ 50.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze acetic acid;1-ethenyl-3-methyl-2H-imidazole with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;1-ethenyl-3-methyl-2H-imidazole?
The IUPAC name of acetic acid;1-ethenyl-3-methyl-2H-imidazole (CID 174673019) is acetic acid;1-ethenyl-3-methyl-2H-imidazole.
What is the SMILES notation for acetic acid;1-ethenyl-3-methyl-2H-imidazole?
The canonical SMILES for acetic acid;1-ethenyl-3-methyl-2H-imidazole is C=CN1C=CN(C)C1.CC(=O)O.
What is the InChIKey of acetic acid;1-ethenyl-3-methyl-2H-imidazole?
The InChIKey is UVQPACCJFWWCEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.C2H4O2/c1-3-8-5-4-7(2)6-8;1-2(3)4/h3-5H,1,6H2,2H3;1H3,(H,3,4).
What are the key properties of acetic acid;1-ethenyl-3-methyl-2H-imidazole?
acetic acid;1-ethenyl-3-methyl-2H-imidazole has a molecular weight of 170.21 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-ethenyl-3-methyl-2H-imidazole is sourced from PubChem (CID 174673019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).