C7H12F3N3O2S — CID 174794926
1-ethenyl-3-methyl-2H-imidazole;trifluoromethanesulfonamide (PubChem CID 174794926) has the molecular formula C7H12F3N3O2S and a molecular weight of 259.25 g/mol. Its IUPAC name is 1-ethenyl-3-methyl-2H-imidazole;trifluoromethanesulfonamide.
| Compound Name | 1-ethenyl-3-methyl-2H-imidazole;trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 174794926 |
| Molecular Formula | C7H12F3N3O2S |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 1-ethenyl-3-methyl-2H-imidazole;trifluoromethanesulfonamide |
| SMILES | C=CN1C=CN(C)C1.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C6H10N2.CH2F3NO2S/c1-3-8-5-4-7(2)6-8;2-1(3,4)8(5,6)7/h3-5H,1,6H2,2H3;(H2,5,6,7) |
| InChIKey | HLEWYJGHIHAPCB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |