C9H14F3N3O2S — CID 175182380
1-ethenyl-3-prop-2-enyl-2H-imidazole;trifluoromethanesulfonamide (PubChem CID 175182380) has the molecular formula C9H14F3N3O2S and a molecular weight of 285.29 g/mol. Its IUPAC name is 1-ethenyl-3-prop-2-enyl-2H-imidazole;trifluoromethanesulfonamide.
| Compound Name | 1-ethenyl-3-prop-2-enyl-2H-imidazole;trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 175182380 |
| Molecular Formula | C9H14F3N3O2S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 1-ethenyl-3-prop-2-enyl-2H-imidazole;trifluoromethanesulfonamide |
| SMILES | C=CCN1C=CN(C=C)C1.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12N2.CH2F3NO2S/c1-3-5-10-7-6-9(4-2)8-10;2-1(3,4)8(5,6)7/h3-4,6-7H,1-2,5,8H2;(H2,5,6,7) |
| InChIKey | XOOHIBGPVKLZMQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|