C11H18BF4N2O2- — CID 174865010
1-ethenyl-3-ethyl-2H-imidazole;2-methylprop-2-enoic acid;tetrafluoroborate (PubChem CID 174865010) has the molecular formula C11H18BF4N2O2- and a molecular weight of 297.08 g/mol. Its IUPAC name is 1-ethenyl-3-ethyl-2H-imidazole;2-methylprop-2-enoic acid;tetrafluoroborate.
| Compound Name | 1-ethenyl-3-ethyl-2H-imidazole;2-methylprop-2-enoic acid;tetrafluoroborate |
|---|---|
| PubChem CID | 174865010 |
| Molecular Formula | C11H18BF4N2O2- |
| Molecular Weight | 297.08 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-ethenyl-3-ethyl-2H-imidazole;2-methylprop-2-enoic acid;tetrafluoroborate |
| SMILES | C=C(C)C(=O)O.C=CN1C=CN(CC)C1.F[B-](F)(F)F |
| InChI | InChI=1S/C7H12N2.C4H6O2.BF4/c1-3-8-5-6-9(4-2)7-8;1-3(2)4(5)6;2-1(3,4)5/h3,5-6H,1,4,7H2,2H3;1H2,2H3,(H,5,6);/q;;-1 |
| InChIKey | QOECTCGWUKKCGB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.08 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|